C41H37N3O2Pt — CID 170933025
(3aR,7aS)-2-[3-[3-tert-butyl-5-(6-methylpyrido[2,3-b]indol-9-yl)benzene-6-id-1-yl]oxy-5-phenylbenzene-2-id-1-yl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole;platinum(2+) (PubChem CID 170933025) has the molecular formula C41H37N3O2Pt and a molecular weight of 798.84 g/mol. Its IUPAC name is (3aR,7aS)-2-[3-[3-tert-butyl-5-(6-methylpyrido[2,3-b]indol-9-yl)benzene-6-id-1-yl]oxy-5-phenylbenzene-2-id-1-yl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole;platinum(2+).
| Compound Name | (3aR,7aS)-2-[3-[3-tert-butyl-5-(6-methylpyrido[2,3-b]indol-9-yl)benzene-6-id-1-yl]oxy-5-phenylbenzene-2-id-1-yl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole;platinum(2+) |
|---|---|
| PubChem CID | 170933025 |
| Molecular Formula | C41H37N3O2Pt |
| Molecular Weight | 798.84 g/mol |
| Exact Mass | 798.25 |
| IUPAC Name | (3aR,7aS)-2-[3-[3-tert-butyl-5-(6-methylpyrido[2,3-b]indol-9-yl)benzene-6-id-1-yl]oxy-5-phenylbenzene-2-id-1-yl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole;platinum(2+) |
| SMILES | Cc1ccc2c(c1)c1cccnc1n2-c1[c-]c(Oc2[c-]c(C3=N[C@@H]4CCCC[C@@H]4O3)cc(-c3ccccc3)c2)cc(C(C)(C)C)c1.[Pt+2] |
| InChI | InChI=1S/C41H37N3O2.Pt/c1-26-16-17-37-35(19-26)34-13-10-18-42-39(34)44(37)31-23-30(41(2,3)4)24-33(25-31)45-32-21-28(27-11-6-5-7-12-27)20-29(22-32)40-43-36-14-8-9-15-38(36)46-40;/h5-7,10-13,16-21,23-24,36,38H,8-9,14-15H2,1-4H3;/q-2;+2/t36-,38+;/m1./s1 |
| InChIKey | IQBTYOGZSWVCIC-ISJXFDSMSA-N |
| XLogP | 9.93 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.84 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|