C40H37N3O2 — CID 170935023
(3aR,6aS)-2-[3-[3-tert-butyl-5-(6-methylpyrido[2,3-b]indol-9-yl)phenoxy]-5-phenylphenyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole (PubChem CID 170935023) has the molecular formula C40H37N3O2 and a molecular weight of 591.76 g/mol. Its IUPAC name is (3aR,6aS)-2-[3-[3-tert-butyl-5-(6-methylpyrido[2,3-b]indol-9-yl)phenoxy]-5-phenylphenyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole.
| Compound Name | (3aR,6aS)-2-[3-[3-tert-butyl-5-(6-methylpyrido[2,3-b]indol-9-yl)phenoxy]-5-phenylphenyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole |
|---|---|
| PubChem CID | 170935023 |
| Molecular Formula | C40H37N3O2 |
| Molecular Weight | 591.76 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | (3aR,6aS)-2-[3-[3-tert-butyl-5-(6-methylpyrido[2,3-b]indol-9-yl)phenoxy]-5-phenylphenyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole |
| SMILES | Cc1ccc2c(c1)c1cccnc1n2-c1cc(Oc2cc(C3=N[C@@H]4CCC[C@@H]4O3)cc(-c3ccccc3)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C40H37N3O2/c1-25-15-16-36-34(18-25)33-12-9-17-41-38(33)43(36)30-22-29(40(2,3)4)23-32(24-30)44-31-20-27(26-10-6-5-7-11-26)19-28(21-31)39-42-35-13-8-14-37(35)45-39/h5-7,9-12,15-24,35,37H,8,13-14H2,1-4H3/t35-,37+/m1/s1 |
| InChIKey | LGBJBWZQLZLXMU-BZFILIQBSA-N |
| XLogP | 9.94 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.76 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |