C60H50N4OPt — CID 170935897
CID 170935897 (PubChem CID 170935897) has the molecular formula C60H50N4OPt and a molecular weight of 1038.16 g/mol.
| Compound Name | CID 170935897 |
|---|---|
| PubChem CID | 170935897 |
| Molecular Formula | C60H50N4OPt |
| Molecular Weight | 1038.16 g/mol |
| Exact Mass | 1037.36 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(N2C(c3[c-]c(Oc4[c-]c5c(cc4C)c4cc(C)cc6c4n5-c4ncccc4C6(C)C)cc(-c4ccccc4)c3)=N[C@@H]3c4ccc(C)cc4-c4cc(C)ccc4[C@@H]32)c(C)c1.[Pt+2] |
| InChI | InChI=1S/C60H50N4O.Pt/c1-33-17-19-44-46(24-33)47-25-34(2)18-20-45(47)57-54(44)62-58(64(57)55-38(6)22-35(3)23-39(55)7)42-29-41(40-14-11-10-12-15-40)30-43(31-42)65-53-32-52-48(28-37(53)5)49-26-36(4)27-51-56(49)63(52)59-50(60(51,8)9)16-13-21-61-59;/h10-30,54,57H,1-9H3;/q-2;+2/t54-,57+;/m1./s1 |
| InChIKey | MNCVZKMHPXDFCA-JIGAJHBRSA-N |
| XLogP | 14.76 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1038.16 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|