About CID 170935870
CID 170935870 (PubChem CID 170935870) has the molecular formula C51H41N3O2Pt
and a molecular weight of 922.99 g/mol.
Molecular Properties
| Compound Name | CID 170935870 |
| PubChem CID | 170935870 |
| Molecular Formula | C51H41N3O2Pt |
| Molecular Weight | 922.99 g/mol |
| Exact Mass | 922.28 |
| IUPAC Name | — |
| SMILES | Cc1cc2c([c-]c1Oc1[c-]c(C3=N[C@H](C(c4ccccc4)c4ccccc4)C(C)(C)O3)cc(-c3ccccc3)c1)-n1c3ncccc3c3cccc(c31)C2(C)C.[Pt+2] |
| InChI | InChI=1S/C51H41N3O2.Pt/c1-32-27-42-43(54-46-39(40-24-16-26-52-48(40)54)23-15-25-41(46)50(42,2)3)31-44(32)55-38-29-36(33-17-9-6-10-18-33)28-37(30-38)49-53-47(51(4,5)56-49)45(34-19-11-7-12-20-34)35-21-13-8-14-22-35;/h6-29,45,47H,1-5H3;/q-2;+2/t47-;/m1./s1 |
| InChIKey | DJUYDEVHGQMKBF-QBGRQLKXSA-N |
| XLogP | 11.94 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 922.99 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 170935870 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170935870?
The IUPAC name of CID 170935870 (CID 170935870) is not available.
What is the SMILES notation for CID 170935870?
The canonical SMILES for CID 170935870 is Cc1cc2c([c-]c1Oc1[c-]c(C3=N[C@H](C(c4ccccc4)c4ccccc4)C(C)(C)O3)cc(-c3ccccc3)c1)-n1c3ncccc3c3cccc(c31)C2(C)C.[Pt+2].
What is the InChIKey of CID 170935870?
The InChIKey is DJUYDEVHGQMKBF-QBGRQLKXSA-N. The full InChI is InChI=1S/C51H41N3O2.Pt/c1-32-27-42-43(54-46-39(40-24-16-26-52-48(40)54)23-15-25-41(46)50(42,2)3)31-44(32)55-38-29-36(33-17-9-6-10-18-33)28-37(30-38)49-53-47(51(4,5)56-49)45(34-19-11-7-12-20-34)35-21-13-8-14-22-35;/h6-29,45,47H,1-5H3;/q-2;+2/t47-;/m1./s1.
What are the key properties of CID 170935870?
CID 170935870 has a molecular weight of 922.99 g/mol, XLogP of 11.94, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170935870 is sourced from PubChem (CID 170935870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).