C75H80N4OPt — CID 170935901
CID 170935901 (PubChem CID 170935901) has the molecular formula C75H80N4OPt and a molecular weight of 1248.57 g/mol.
| Compound Name | CID 170935901 |
|---|---|
| PubChem CID | 170935901 |
| Molecular Formula | C75H80N4OPt |
| Molecular Weight | 1248.57 g/mol |
| Exact Mass | 1247.60 |
| IUPAC Name | — |
| SMILES | Cc1cc2c([c-]c1Oc1[c-]c(C3=N[C@@H]4c5cc(C)c(C)c(C)c5-c5c(cc(C)c(C)c5C)[C@]4(C)N3c3c(C)c(C)cc(C)c3C)cc(-c3c(C(C)C)cccc3C(C)C)c1)-n1c3ncccc3c3cc(C(C)(C)C)cc(c31)C2(C)C.[Pt+2] |
| InChI | InChI=1S/C75H80N4O.Pt/c1-38(2)55-24-22-25-56(39(3)4)67(55)51-32-52(34-54(33-51)80-64-37-63-60(31-44(64)9)74(19,20)62-36-53(73(16,17)18)35-58-57-26-23-27-76-72(57)78(63)69(58)62)71-77-70-59-29-42(7)45(10)49(14)65(59)66-50(15)46(11)43(8)30-61(66)75(70,21)79(71)68-47(12)40(5)28-41(6)48(68)13;/h22-33,35-36,38-39,70H,1-21H3;/q-2;+2/t70-,75+;/m1./s1 |
| InChIKey | FIXODLZTMFIECT-KWDOSCQNSA-N |
| XLogP | 19.72 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1248.57 |
| LogP ≤ 5 | 19.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|