About CID 170934624
CID 170934624 (PubChem CID 170934624) has the molecular formula C56H57N3O2Pt
and a molecular weight of 999.17 g/mol.
Molecular Properties
| Compound Name | CID 170934624 |
| PubChem CID | 170934624 |
| Molecular Formula | C56H57N3O2Pt |
| Molecular Weight | 999.17 g/mol |
| Exact Mass | 998.41 |
| IUPAC Name | — |
| SMILES | Cc1cc2c([c-]c1Oc1[c-]c(C3=N[C@@H]4c5cc(C)c(C)c(C)c5-c5c(cc(C)c(C)c5C)[C@]4(C)O3)cc(C(C)C)c1)-n1c3ncccc3c3cc(C(C)(C)C)cc(c31)C2(C)C.[Pt+2] |
| InChI | InChI=1S/C56H57N3O2.Pt/c1-28(2)36-22-37(53-58-51-42-19-29(3)32(6)34(8)48(42)49-35(9)33(7)30(4)20-44(49)56(51,15)61-53)24-39(23-36)60-47-27-46-43(21-31(47)5)55(13,14)45-26-38(54(10,11)12)25-41-40-17-16-18-57-52(40)59(46)50(41)45;/h16-23,25-26,28,51H,1-15H3;/q-2;+2/t51-,56+;/m1./s1 |
| InChIKey | AGESCZJSLVNDSE-HOZKGGIPSA-N |
| XLogP | 14.20 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 999.17 |
| LogP ≤ 5 | 14.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 170934624 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170934624?
The IUPAC name of CID 170934624 (CID 170934624) is not available.
What is the SMILES notation for CID 170934624?
The canonical SMILES for CID 170934624 is Cc1cc2c([c-]c1Oc1[c-]c(C3=N[C@@H]4c5cc(C)c(C)c(C)c5-c5c(cc(C)c(C)c5C)[C@]4(C)O3)cc(C(C)C)c1)-n1c3ncccc3c3cc(C(C)(C)C)cc(c31)C2(C)C.[Pt+2].
What is the InChIKey of CID 170934624?
The InChIKey is AGESCZJSLVNDSE-HOZKGGIPSA-N. The full InChI is InChI=1S/C56H57N3O2.Pt/c1-28(2)36-22-37(53-58-51-42-19-29(3)32(6)34(8)48(42)49-35(9)33(7)30(4)20-44(49)56(51,15)61-53)24-39(23-36)60-47-27-46-43(21-31(47)5)55(13,14)45-26-38(54(10,11)12)25-41-40-17-16-18-57-52(40)59(46)50(41)45;/h16-23,25-26,28,51H,1-15H3;/q-2;+2/t51-,56+;/m1./s1.
What are the key properties of CID 170934624?
CID 170934624 has a molecular weight of 999.17 g/mol, XLogP of 14.20, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170934624 is sourced from PubChem (CID 170934624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).