C47H34N4OPtS — CID 176782652
CID 176782652 (PubChem CID 176782652) has the molecular formula C47H34N4OPtS and a molecular weight of 897.96 g/mol.
| Compound Name | CID 176782652 |
|---|---|
| PubChem CID | 176782652 |
| Molecular Formula | C47H34N4OPtS |
| Molecular Weight | 897.96 g/mol |
| Exact Mass | 897.21 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc2c3c(c1)c1cccnc1n3-c1[c-]c(Oc3[c-]c4c(cc3)c3ccc5sc6ccccc6c5c3n4-c3ccccn3)ccc1C2(C)C.[Pt+2] |
| InChI | InChI=1S/C47H34N4OS.Pt/c1-46(2,3)27-23-34-32-12-10-22-49-45(32)51-38-26-29(16-19-35(38)47(4,5)36(24-27)43(34)51)52-28-15-17-30-31-18-20-40-42(33-11-6-7-13-39(33)53-40)44(31)50(37(30)25-28)41-14-8-9-21-48-41;/h6-24H,1-5H3;/q-2;+2 |
| InChIKey | VGWHWTQZWRWOTM-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.96 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|