C44H26N4OPtS — CID 176783442
10-[3-(3,4-diphenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-12-pyridin-2-yl-11H-[1]benzothiolo[3,2-a]carbazol-11-ide;platinum(2+) (PubChem CID 176783442) has the molecular formula C44H26N4OPtS and a molecular weight of 853.86 g/mol. Its IUPAC name is 10-[3-(3,4-diphenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-12-pyridin-2-yl-11H-[1]benzothiolo[3,2-a]carbazol-11-ide;platinum(2+).
| Compound Name | 10-[3-(3,4-diphenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-12-pyridin-2-yl-11H-[1]benzothiolo[3,2-a]carbazol-11-ide;platinum(2+) |
|---|---|
| PubChem CID | 176783442 |
| Molecular Formula | C44H26N4OPtS |
| Molecular Weight | 853.86 g/mol |
| Exact Mass | 853.15 |
| IUPAC Name | 10-[3-(3,4-diphenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-12-pyridin-2-yl-11H-[1]benzothiolo[3,2-a]carbazol-11-ide;platinum(2+) |
| SMILES | [Pt+2].[c-]1c(Oc2[c-]c3c(cc2)c2ccc4sc5ccccc5c4c2n3-c2ccccn2)cccc1-n1cc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C44H26N4OS.Pt/c1-3-12-29(13-4-1)37-28-47(46-43(37)30-14-5-2-6-15-30)31-16-11-17-32(26-31)49-33-21-22-34-35-23-24-40-42(36-18-7-8-19-39(36)50-40)44(35)48(38(34)27-33)41-20-9-10-25-45-41;/h1-25,28H;/q-2;+2 |
| InChIKey | HKAHEVQQXXTSCG-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.86 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|