C43H40N4O2Pt — CID 170935390
CID 170935390 (PubChem CID 170935390) has the molecular formula C43H40N4O2Pt and a molecular weight of 839.90 g/mol.
| Compound Name | CID 170935390 |
|---|---|
| PubChem CID | 170935390 |
| Molecular Formula | C43H40N4O2Pt |
| Molecular Weight | 839.90 g/mol |
| Exact Mass | 839.28 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1)C[C@]1(C)OC(c3[c-]c(Oc4[c-]c5c(cc4C)C(C)(C)c4cc(C(C)(C)C)cc6c7cccnc7n-5c46)ncc3)=N[C@]21C.[Pt+2] |
| InChI | InChI=1S/C43H40N4O2.Pt/c1-24-12-13-31-27(17-24)23-42(8)43(31,9)46-39(49-42)26-14-16-44-36(19-26)48-35-22-34-32(18-25(35)2)41(6,7)33-21-28(40(3,4)5)20-30-29-11-10-15-45-38(29)47(34)37(30)33;/h10-18,20-21H,23H2,1-9H3;/q-2;+2/t42-,43+;/m0./s1 |
| InChIKey | NUCXXWGSMGVCKR-BCZCHPDVSA-N |
| XLogP | 9.52 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.90 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|