C45H43N3O2Pt — CID 170932385
CID 170932385 (PubChem CID 170932385) has the molecular formula C45H43N3O2Pt and a molecular weight of 852.94 g/mol.
| Compound Name | CID 170932385 |
|---|---|
| PubChem CID | 170932385 |
| Molecular Formula | C45H43N3O2Pt |
| Molecular Weight | 852.94 g/mol |
| Exact Mass | 852.30 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1)C(C)(C)C[C@@H]1OC(c3[c-]c(Oc4[c-]c5c(cc4C)C(C)(C)c4cccc6c7c(C)ccnc7n-5c46)c(C)cc3C)=N[C@]21C.[Pt+2] |
| InChI | InChI=1S/C45H43N3O2.Pt/c1-24-14-15-31-33(18-24)43(6,7)23-38-45(31,10)47-42(50-38)30-21-36(27(4)19-26(30)3)49-37-22-35-34(20-28(37)5)44(8,9)32-13-11-12-29-39-25(2)16-17-46-41(39)48(35)40(29)32;/h11-20,38H,23H2,1-10H3;/q-2;+2/t38-,45+;/m0./s1 |
| InChIKey | ZPMCVWDKTBCOLV-IJCFCCLISA-N |
| XLogP | 10.49 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.94 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|