About CID 170933439
CID 170933439 (PubChem CID 170933439) has the molecular formula C50H46N4OPt
and a molecular weight of 914.02 g/mol.
Molecular Properties
| Compound Name | CID 170933439 |
| PubChem CID | 170933439 |
| Molecular Formula | C50H46N4OPt |
| Molecular Weight | 914.02 g/mol |
| Exact Mass | 913.33 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(N2C(c3[c-]c(Oc4[c-]c5c(cc4C)C(C)(C)c4cccc6c7cc(C)cnc7n-5c46)c(C)cc3)=N[C@]3(C)Cc4ccccc4[C@]23C)c(C)c1.[Pt+2] |
| InChI | InChI=1S/C50H46N4O.Pt/c1-28-20-32(5)44(33(6)21-28)54-46(52-49(9)26-35-14-11-12-16-38(35)50(49,54)10)34-19-18-30(3)42(24-34)55-43-25-41-40(23-31(43)4)48(7,8)39-17-13-15-36-37-22-29(2)27-51-47(37)53(41)45(36)39;/h11-23,27H,26H2,1-10H3;/q-2;+2/t49-,50+;/m1./s1 |
| InChIKey | YDKSGLQXRIXELU-JQRJIHFVSA-N |
| XLogP | 11.56 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 914.02 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 170933439 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170933439?
The IUPAC name of CID 170933439 (CID 170933439) is not available.
What is the SMILES notation for CID 170933439?
The canonical SMILES for CID 170933439 is Cc1cc(C)c(N2C(c3[c-]c(Oc4[c-]c5c(cc4C)C(C)(C)c4cccc6c7cc(C)cnc7n-5c46)c(C)cc3)=N[C@]3(C)Cc4ccccc4[C@]23C)c(C)c1.[Pt+2].
What is the InChIKey of CID 170933439?
The InChIKey is YDKSGLQXRIXELU-JQRJIHFVSA-N. The full InChI is InChI=1S/C50H46N4O.Pt/c1-28-20-32(5)44(33(6)21-28)54-46(52-49(9)26-35-14-11-12-16-38(35)50(49,54)10)34-19-18-30(3)42(24-34)55-43-25-41-40(23-31(43)4)48(7,8)39-17-13-15-36-37-22-29(2)27-51-47(37)53(41)45(36)39;/h11-23,27H,26H2,1-10H3;/q-2;+2/t49-,50+;/m1./s1.
What are the key properties of CID 170933439?
CID 170933439 has a molecular weight of 914.02 g/mol, XLogP of 11.56, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170933439 is sourced from PubChem (CID 170933439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).