C46H45N3O2PtS — CID 170935662
CID 170935662 (PubChem CID 170935662) has the molecular formula C46H45N3O2PtS and a molecular weight of 899.03 g/mol.
| Compound Name | CID 170935662 |
|---|---|
| PubChem CID | 170935662 |
| Molecular Formula | C46H45N3O2PtS |
| Molecular Weight | 899.03 g/mol |
| Exact Mass | 898.29 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c2c(c1)[C@@]1(C)N=C(c3[c-]c(S(=O)c4[c-]c5c(cc4C)C(C)(C)c4cccc6c7c(C)ccnc7n-5c46)c(C)cc3C)O[C@@]1(C)C2(C)C.[Pt+2] |
| InChI | InChI=1S/C46H45N3O2S.Pt/c1-24-18-29(6)39-34(19-24)45(11)46(12,44(39,9)10)51-42(48-45)31-22-36(27(4)20-26(31)3)52(50)37-23-35-33(21-28(37)5)43(7,8)32-15-13-14-30-38-25(2)16-17-47-41(38)49(35)40(30)32;/h13-21H,1-12H3;/q-2;+2/t45-,46+,52?;/m1./s1 |
| InChIKey | VNRSQFGYBYJYBG-WKDIIIPMSA-N |
| XLogP | 10.18 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.03 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|