C12H16Br2ClN — CID 170936550
3,5-dibromo-4-chloro-N,N-di(propan-2-yl)aniline (PubChem CID 170936550) has the molecular formula C12H16Br2ClN and a molecular weight of 369.53 g/mol. Its IUPAC name is 3,5-dibromo-4-chloro-N,N-di(propan-2-yl)aniline.
| Compound Name | 3,5-dibromo-4-chloro-N,N-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 170936550 |
| Molecular Formula | C12H16Br2ClN |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 366.93 |
| IUPAC Name | 3,5-dibromo-4-chloro-N,N-di(propan-2-yl)aniline |
| SMILES | CC(C)N(c1cc(Br)c(Cl)c(Br)c1)C(C)C |
| InChI | InChI=1S/C12H16Br2ClN/c1-7(2)16(8(3)4)9-5-10(13)12(15)11(14)6-9/h5-8H,1-4H3 |
| InChIKey | DXOZCEUUHTVREV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|