C16H17ClFN3O3 — CID 170938341
methyl 4-[(2-chloroacetyl)amino]-3-[[1-(cyanomethyl)cyclopropyl]methylamino]-5-fluorobenzoate (PubChem CID 170938341) has the molecular formula C16H17ClFN3O3 and a molecular weight of 353.78 g/mol. Its IUPAC name is methyl 4-[(2-chloroacetyl)amino]-3-[[1-(cyanomethyl)cyclopropyl]methylamino]-5-fluorobenzoate.
| Compound Name | methyl 4-[(2-chloroacetyl)amino]-3-[[1-(cyanomethyl)cyclopropyl]methylamino]-5-fluorobenzoate |
|---|---|
| PubChem CID | 170938341 |
| Molecular Formula | C16H17ClFN3O3 |
| Molecular Weight | 353.78 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | methyl 4-[(2-chloroacetyl)amino]-3-[[1-(cyanomethyl)cyclopropyl]methylamino]-5-fluorobenzoate |
| SMILES | COC(=O)c1cc(F)c(NC(=O)CCl)c(NCC2(CC#N)CC2)c1 |
| InChI | InChI=1S/C16H17ClFN3O3/c1-24-15(23)10-6-11(18)14(21-13(22)8-17)12(7-10)20-9-16(2-3-16)4-5-19/h6-7,20H,2-4,8-9H2,1H3,(H,21,22) |
| InChIKey | JGXCWIAYRRPNFJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.78 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|