C60H42N3Na-2 — CID 170940427
CID 170940427 (PubChem CID 170940427) has the molecular formula C60H42N3Na-2 and a molecular weight of 828.01 g/mol.
| Compound Name | CID 170940427 |
|---|---|
| PubChem CID | 170940427 |
| Molecular Formula | C60H42N3Na-2 |
| Molecular Weight | 828.01 g/mol |
| Exact Mass | 827.33 |
| IUPAC Name | — |
| SMILES | CC(C)c1c2c3c4c(cc5c6ccccc6n(c2c(C(C)C)c2c6[c-]c(-c7[c-]cccc7)cc7c8ccccc8n(c12)c67)c53)c1ccccc1n4-c1ccccc1.[Na+].[c-]1ccccc1 |
| InChI | InChI=1S/C54H37N3.C6H5.Na/c1-30(2)45-47-41-28-33(32-17-7-5-8-18-32)27-38-35-21-12-15-25-43(35)56(50(38)41)53(47)46(31(3)4)48-49-51-39(29-40-37-23-13-16-26-44(37)57(52(40)49)54(45)48)36-22-11-14-24-42(36)55(51)34-19-9-6-10-20-34;1-2-4-6-5-3-1;/h5-17,19-27,29-31H,1-4H3;1-5H;/q-2;-1;+1 |
| InChIKey | BDJVXHZZPWGFLT-UHFFFAOYSA-N |
| XLogP | 13.09 |
| TPSA | 13.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.01 |
| LogP ≤ 5 | 13.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|