C26H23N5O3 — CID 170941268
4-(3-cyanophenyl)-3-cyclopropyloxy-N-[(5-hydroxy-4-methylpyrazolo[4,3-c]pyridin-7-yl)methyl]-N-methylbenzamide (PubChem CID 170941268) has the molecular formula C26H23N5O3 and a molecular weight of 453.50 g/mol. Its IUPAC name is 4-(3-cyanophenyl)-3-cyclopropyloxy-N-[(5-hydroxy-4-methylpyrazolo[4,3-c]pyridin-7-yl)methyl]-N-methylbenzamide.
| Compound Name | 4-(3-cyanophenyl)-3-cyclopropyloxy-N-[(5-hydroxy-4-methylpyrazolo[4,3-c]pyridin-7-yl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 170941268 |
| Molecular Formula | C26H23N5O3 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 4-(3-cyanophenyl)-3-cyclopropyloxy-N-[(5-hydroxy-4-methylpyrazolo[4,3-c]pyridin-7-yl)methyl]-N-methylbenzamide |
| SMILES | Cc1c2cnnc-2c(CN(C)C(=O)c2ccc(-c3cccc(C#N)c3)c(OC3CC3)c2)cn1O |
| InChI | InChI=1S/C26H23N5O3/c1-16-23-13-28-29-25(23)20(15-31(16)33)14-30(2)26(32)19-6-9-22(24(11-19)34-21-7-8-21)18-5-3-4-17(10-18)12-27/h3-6,9-11,13,15,21,33H,7-8,14H2,1-2H3 |
| InChIKey | ARXKXNHASSODCG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|