C8H6BrF3N2O — CID 170943583
N-[5-(bromomethyl)-2-pyridinyl]-2,2,2-trifluoroacetamide (PubChem CID 170943583) has the molecular formula C8H6BrF3N2O and a molecular weight of 283.05 g/mol. Its IUPAC name is N-[5-(bromomethyl)-2-pyridinyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[5-(bromomethyl)-2-pyridinyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 170943583 |
| Molecular Formula | C8H6BrF3N2O |
| Molecular Weight | 283.05 g/mol |
| Exact Mass | 281.96 |
| IUPAC Name | N-[5-(bromomethyl)-2-pyridinyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1ccc(CBr)cn1)C(F)(F)F |
| InChI | InChI=1S/C8H6BrF3N2O/c9-3-5-1-2-6(13-4-5)14-7(15)8(10,11)12/h1-2,4H,3H2,(H,13,14,15) |
| InChIKey | DLNFKIMRHAKRCY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.05 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|