C16H12ClF3N4O3 — CID 139521647
N-[5-[(3-chlorophenyl)methyl]-2-pyridinyl]-2-oxo-2-[2-(2,2,2-trifluoroacetyl)hydrazinyl]acetamide (PubChem CID 139521647) has the molecular formula C16H12ClF3N4O3 and a molecular weight of 400.74 g/mol. Its IUPAC name is N-[5-[(3-chlorophenyl)methyl]-2-pyridinyl]-2-oxo-2-[2-(2,2,2-trifluoroacetyl)hydrazinyl]acetamide.
| Compound Name | N-[5-[(3-chlorophenyl)methyl]-2-pyridinyl]-2-oxo-2-[2-(2,2,2-trifluoroacetyl)hydrazinyl]acetamide |
|---|---|
| PubChem CID | 139521647 |
| Molecular Formula | C16H12ClF3N4O3 |
| Molecular Weight | 400.74 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N-[5-[(3-chlorophenyl)methyl]-2-pyridinyl]-2-oxo-2-[2-(2,2,2-trifluoroacetyl)hydrazinyl]acetamide |
| SMILES | O=C(NNC(=O)C(F)(F)F)C(=O)Nc1ccc(Cc2cccc(Cl)c2)cn1 |
| InChI | InChI=1S/C16H12ClF3N4O3/c17-11-3-1-2-9(7-11)6-10-4-5-12(21-8-10)22-13(25)14(26)23-24-15(27)16(18,19)20/h1-5,7-8H,6H2,(H,23,26)(H,24,27)(H,21,22,25) |
| InChIKey | XIKHHRLXUSTBNN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.74 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|