C12H24N2O4 — CID 170943611
tert-butyl N-[(1S,2S)-1-cyclopropyl-2-hydroxy-2-(methoxymethylamino)ethyl]carbamate (PubChem CID 170943611) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S)-1-cyclopropyl-2-hydroxy-2-(methoxymethylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S)-1-cyclopropyl-2-hydroxy-2-(methoxymethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 170943611 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | tert-butyl N-[(1S,2S)-1-cyclopropyl-2-hydroxy-2-(methoxymethylamino)ethyl]carbamate |
| SMILES | COCN[C@@H](O)[C@@H](NC(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C12H24N2O4/c1-12(2,3)18-11(16)14-9(8-5-6-8)10(15)13-7-17-4/h8-10,13,15H,5-7H2,1-4H3,(H,14,16)/t9-,10-/m0/s1 |
| InChIKey | FWGXFVDSMFFSAK-UWVGGRQHSA-N |
| XLogP | 0.80 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|