C10H22N2O4 — CID 141468763
tert-butyl N-[1-hydroxy-1-(methoxymethylamino)propan-2-yl]carbamate (PubChem CID 141468763) has the molecular formula C10H22N2O4 and a molecular weight of 234.30 g/mol. Its IUPAC name is tert-butyl N-[1-hydroxy-1-(methoxymethylamino)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-hydroxy-1-(methoxymethylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 141468763 |
| Molecular Formula | C10H22N2O4 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | tert-butyl N-[1-hydroxy-1-(methoxymethylamino)propan-2-yl]carbamate |
| SMILES | COCNC(O)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H22N2O4/c1-7(8(13)11-6-15-5)12-9(14)16-10(2,3)4/h7-8,11,13H,6H2,1-5H3,(H,12,14) |
| InChIKey | FGOXYYBPGAOORM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|