C11H24N2O3 — CID 167208112
tert-butyl N-[1-[2-methoxyethyl(methyl)amino]ethyl]carbamate (PubChem CID 167208112) has the molecular formula C11H24N2O3 and a molecular weight of 232.32 g/mol. Its IUPAC name is tert-butyl N-[1-[2-methoxyethyl(methyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[2-methoxyethyl(methyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 167208112 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | tert-butyl N-[1-[2-methoxyethyl(methyl)amino]ethyl]carbamate |
| SMILES | COCCN(C)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H24N2O3/c1-9(13(5)7-8-15-6)12-10(14)16-11(2,3)4/h9H,7-8H2,1-6H3,(H,12,14) |
| InChIKey | DDFSCZHFXBDTBO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|