C11H22N2O4 — CID 87494634
tert-butyl N-[1-(dimethylamino)-3-methoxy-1-oxopropan-2-yl]carbamate (PubChem CID 87494634) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is tert-butyl N-[1-(dimethylamino)-3-methoxy-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(dimethylamino)-3-methoxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 87494634 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | tert-butyl N-[1-(dimethylamino)-3-methoxy-1-oxopropan-2-yl]carbamate |
| SMILES | COCC(NC(=O)OC(C)(C)C)C(=O)N(C)C |
| InChI | InChI=1S/C11H22N2O4/c1-11(2,3)17-10(15)12-8(7-16-6)9(14)13(4)5/h8H,7H2,1-6H3,(H,12,15) |
| InChIKey | RUFKIDLYURTWOT-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |