C11H22N2O5S — CID 89440433
tert-butyl N-[(2R)-1-(dimethylamino)-3-methylsulfonyl-1-oxopropan-2-yl]carbamate (PubChem CID 89440433) has the molecular formula C11H22N2O5S and a molecular weight of 294.37 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(dimethylamino)-3-methylsulfonyl-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(dimethylamino)-3-methylsulfonyl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 89440433 |
| Molecular Formula | C11H22N2O5S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | tert-butyl N-[(2R)-1-(dimethylamino)-3-methylsulfonyl-1-oxopropan-2-yl]carbamate |
| SMILES | CN(C)C(=O)[C@H](CS(C)(=O)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22N2O5S/c1-11(2,3)18-10(15)12-8(7-19(6,16)17)9(14)13(4)5/h8H,7H2,1-6H3,(H,12,15)/t8-/m0/s1 |
| InChIKey | MATNWFRGABIXKI-QMMMGPOBSA-N |
| XLogP | 0.01 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |