C12H21N3O5S — CID 87927484
tert-butyl N-[1-(1-cyanoethylamino)-3-methylsulfonyl-1-oxopropan-2-yl]carbamate (PubChem CID 87927484) has the molecular formula C12H21N3O5S and a molecular weight of 319.38 g/mol. Its IUPAC name is tert-butyl N-[1-(1-cyanoethylamino)-3-methylsulfonyl-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(1-cyanoethylamino)-3-methylsulfonyl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 87927484 |
| Molecular Formula | C12H21N3O5S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | tert-butyl N-[1-(1-cyanoethylamino)-3-methylsulfonyl-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C#N)NC(=O)C(CS(C)(=O)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21N3O5S/c1-8(6-13)14-10(16)9(7-21(5,18)19)15-11(17)20-12(2,3)4/h8-9H,7H2,1-5H3,(H,14,16)(H,15,17) |
| InChIKey | AXHRNHQYHHZRCL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |