C15H21ClN4O — CID 170944208
N-[3-[(2-chloro-5-cyclopropylpyrimidin-4-yl)amino]propyl]-N-cyclobutylformamide (PubChem CID 170944208) has the molecular formula C15H21ClN4O and a molecular weight of 308.81 g/mol. Its IUPAC name is N-[3-[(2-chloro-5-cyclopropylpyrimidin-4-yl)amino]propyl]-N-cyclobutylformamide.
| Compound Name | N-[3-[(2-chloro-5-cyclopropylpyrimidin-4-yl)amino]propyl]-N-cyclobutylformamide |
|---|---|
| PubChem CID | 170944208 |
| Molecular Formula | C15H21ClN4O |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | N-[3-[(2-chloro-5-cyclopropylpyrimidin-4-yl)amino]propyl]-N-cyclobutylformamide |
| SMILES | O=CN(CCCNc1nc(Cl)ncc1C1CC1)C1CCC1 |
| InChI | InChI=1S/C15H21ClN4O/c16-15-18-9-13(11-5-6-11)14(19-15)17-7-2-8-20(10-21)12-3-1-4-12/h9-12H,1-8H2,(H,17,18,19) |
| InChIKey | JVHLHBNRHBWLQC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|