C19H31NO4 — CID 170945321
[4-hydroxy-3-(3-methoxyphenyl)heptyl] N-tert-butylcarbamate (PubChem CID 170945321) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is [4-hydroxy-3-(3-methoxyphenyl)heptyl] N-tert-butylcarbamate.
| Compound Name | [4-hydroxy-3-(3-methoxyphenyl)heptyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 170945321 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | [4-hydroxy-3-(3-methoxyphenyl)heptyl] N-tert-butylcarbamate |
| SMILES | CCCC(O)C(CCOC(=O)NC(C)(C)C)c1cccc(OC)c1 |
| InChI | InChI=1S/C19H31NO4/c1-6-8-17(21)16(14-9-7-10-15(13-14)23-5)11-12-24-18(22)20-19(2,3)4/h7,9-10,13,16-17,21H,6,8,11-12H2,1-5H3,(H,20,22) |
| InChIKey | VVLYIFJLUHZONA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |