C24H32N2O6 — CID 170945967
(2S)-4-[[2-[(3-methoxyphenyl)methoxy]phenyl]methylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 170945967) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is (2S)-4-[[2-[(3-methoxyphenyl)methoxy]phenyl]methylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | (2S)-4-[[2-[(3-methoxyphenyl)methoxy]phenyl]methylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 170945967 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | (2S)-4-[[2-[(3-methoxyphenyl)methoxy]phenyl]methylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | COc1cccc(COc2ccccc2CNCC[C@H](NC(=O)OC(C)(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C24H32N2O6/c1-24(2,3)32-23(29)26-20(22(27)28)12-13-25-15-18-9-5-6-11-21(18)31-16-17-8-7-10-19(14-17)30-4/h5-11,14,20,25H,12-13,15-16H2,1-4H3,(H,26,29)(H,27,28)/t20-/m0/s1 |
| InChIKey | NJOXTRKOUNCSEP-FQEVSTJZSA-N |
| XLogP | 3.73 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|