C24H31N3O6 — CID 170945961
(2S)-4-[[2-[(3-methoxybenzoyl)amino]phenyl]methylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 170945961) has the molecular formula C24H31N3O6 and a molecular weight of 457.53 g/mol. Its IUPAC name is (2S)-4-[[2-[(3-methoxybenzoyl)amino]phenyl]methylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | (2S)-4-[[2-[(3-methoxybenzoyl)amino]phenyl]methylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 170945961 |
| Molecular Formula | C24H31N3O6 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | (2S)-4-[[2-[(3-methoxybenzoyl)amino]phenyl]methylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | COc1cccc(C(=O)Nc2ccccc2CNCC[C@H](NC(=O)OC(C)(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C24H31N3O6/c1-24(2,3)33-23(31)27-20(22(29)30)12-13-25-15-17-8-5-6-11-19(17)26-21(28)16-9-7-10-18(14-16)32-4/h5-11,14,20,25H,12-13,15H2,1-4H3,(H,26,28)(H,27,31)(H,29,30)/t20-/m0/s1 |
| InChIKey | MOSQEWGYMVSROG-FQEVSTJZSA-N |
| XLogP | 3.41 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|