About 3H-imidazo[1,2-a]pyridin-3-ide;rubidium(1+)
3H-imidazo[1,2-a]pyridin-3-ide;rubidium(1+) (PubChem CID 170948120) has the molecular formula C7H5N2Rb
and a molecular weight of 202.60 g/mol. Its IUPAC name is 3H-imidazo[1,2-a]pyridin-3-ide;rubidium(1+).
Molecular Properties
| Compound Name | 3H-imidazo[1,2-a]pyridin-3-ide;rubidium(1+) |
| PubChem CID | 170948120 |
| Molecular Formula | C7H5N2Rb |
| Molecular Weight | 202.60 g/mol |
| Exact Mass | 201.96 |
| IUPAC Name | 3H-imidazo[1,2-a]pyridin-3-ide;rubidium(1+) |
| SMILES | [Rb+].[c-]1cnc2ccccn12 |
| InChI | InChI=1S/C7H5N2.Rb/c1-2-5-9-6-4-8-7(9)3-1;/h1-5H;/q-1;+1 |
| InChIKey | MUSMUUOVRUPJLF-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.60 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3H-imidazo[1,2-a]pyridin-3-ide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-imidazo[1,2-a]pyridin-3-ide;rubidium(1+)?
The IUPAC name of 3H-imidazo[1,2-a]pyridin-3-ide;rubidium(1+) (CID 170948120) is 3H-imidazo[1,2-a]pyridin-3-ide;rubidium(1+).
What is the SMILES notation for 3H-imidazo[1,2-a]pyridin-3-ide;rubidium(1+)?
The canonical SMILES for 3H-imidazo[1,2-a]pyridin-3-ide;rubidium(1+) is [Rb+].[c-]1cnc2ccccn12.
What is the InChIKey of 3H-imidazo[1,2-a]pyridin-3-ide;rubidium(1+)?
The InChIKey is MUSMUUOVRUPJLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N2.Rb/c1-2-5-9-6-4-8-7(9)3-1;/h1-5H;/q-1;+1.
What are the key properties of 3H-imidazo[1,2-a]pyridin-3-ide;rubidium(1+)?
3H-imidazo[1,2-a]pyridin-3-ide;rubidium(1+) has a molecular weight of 202.60 g/mol, XLogP of -1.86, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-imidazo[1,2-a]pyridin-3-ide;rubidium(1+) is sourced from PubChem (CID 170948120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).