C32H40F4N6O2 — CID 170948604
N-[5-[6,6-dimethyl-2-(4-methyl-1,2,4-triazol-3-yl)spiro[3.3]heptan-2-yl]-2-fluorophenyl]-5-[(3-methylbutylamino)methyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide (PubChem CID 170948604) has the molecular formula C32H40F4N6O2 and a molecular weight of 616.70 g/mol. Its IUPAC name is N-[5-[6,6-dimethyl-2-(4-methyl-1,2,4-triazol-3-yl)spiro[3.3]heptan-2-yl]-2-fluorophenyl]-5-[(3-methylbutylamino)methyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide.
| Compound Name | N-[5-[6,6-dimethyl-2-(4-methyl-1,2,4-triazol-3-yl)spiro[3.3]heptan-2-yl]-2-fluorophenyl]-5-[(3-methylbutylamino)methyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170948604 |
| Molecular Formula | C32H40F4N6O2 |
| Molecular Weight | 616.70 g/mol |
| Exact Mass | 616.31 |
| IUPAC Name | N-[5-[6,6-dimethyl-2-(4-methyl-1,2,4-triazol-3-yl)spiro[3.3]heptan-2-yl]-2-fluorophenyl]-5-[(3-methylbutylamino)methyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
| SMILES | CC(C)CCNCc1cc(C(=O)Nc2cc(C3(c4nncn4C)CC4(CC(C)(C)C4)C3)ccc2F)c(=O)n(CC(F)(F)F)c1 |
| InChI | InChI=1S/C32H40F4N6O2/c1-20(2)8-9-37-12-21-10-23(27(44)42(13-21)18-32(34,35)36)26(43)39-25-11-22(6-7-24(25)33)31(28-40-38-19-41(28)5)16-30(17-31)14-29(3,4)15-30/h6-7,10-11,13,19-20,37H,8-9,12,14-18H2,1-5H3,(H,39,43) |
| InChIKey | WXSJVRBKTRQSES-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.70 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|