C24H24F3N5O3 — CID 170948530
N-[3-[3,3-dimethyl-1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]phenyl]-5-formyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide (PubChem CID 170948530) has the molecular formula C24H24F3N5O3 and a molecular weight of 487.48 g/mol. Its IUPAC name is N-[3-[3,3-dimethyl-1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]phenyl]-5-formyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide.
| Compound Name | N-[3-[3,3-dimethyl-1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]phenyl]-5-formyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170948530 |
| Molecular Formula | C24H24F3N5O3 |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | N-[3-[3,3-dimethyl-1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]phenyl]-5-formyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
| SMILES | Cn1cnnc1C1(c2cccc(NC(=O)c3cc(C=O)cn(CC(F)(F)F)c3=O)c2)CC(C)(C)C1 |
| InChI | InChI=1S/C24H24F3N5O3/c1-22(2)11-23(12-22,21-30-28-14-31(21)3)16-5-4-6-17(8-16)29-19(34)18-7-15(10-33)9-32(20(18)35)13-24(25,26)27/h4-10,14H,11-13H2,1-3H3,(H,29,34) |
| InChIKey | PJUSQSAQUFUQMA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|