C29H37F3N6O2 — CID 170948554
N-[3-[3,3-dimethyl-1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]phenyl]-5-[1-(2-methylpropylamino)ethyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide (PubChem CID 170948554) has the molecular formula C29H37F3N6O2 and a molecular weight of 558.65 g/mol. Its IUPAC name is N-[3-[3,3-dimethyl-1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]phenyl]-5-[1-(2-methylpropylamino)ethyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide.
| Compound Name | N-[3-[3,3-dimethyl-1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]phenyl]-5-[1-(2-methylpropylamino)ethyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170948554 |
| Molecular Formula | C29H37F3N6O2 |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | N-[3-[3,3-dimethyl-1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]phenyl]-5-[1-(2-methylpropylamino)ethyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
| SMILES | CC(C)CNC(C)c1cc(C(=O)Nc2cccc(C3(c4nncn4C)CC(C)(C)C3)c2)c(=O)n(CC(F)(F)F)c1 |
| InChI | InChI=1S/C29H37F3N6O2/c1-18(2)12-33-19(3)20-10-23(25(40)38(13-20)16-29(30,31)32)24(39)35-22-9-7-8-21(11-22)28(14-27(4,5)15-28)26-36-34-17-37(26)6/h7-11,13,17-19,33H,12,14-16H2,1-6H3,(H,35,39) |
| InChIKey | GYRPJOHMNQKNJT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |