C27H27ClN4O5 — CID 170949141
[4-[5-(4-chlorophenyl)-3-quinoxalin-6-yl-3,4-dihydropyrazol-2-yl]-4-oxobutanoyl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 170949141) has the molecular formula C27H27ClN4O5 and a molecular weight of 522.99 g/mol. Its IUPAC name is [4-[5-(4-chlorophenyl)-3-quinoxalin-6-yl-3,4-dihydropyrazol-2-yl]-4-oxobutanoyl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [4-[5-(4-chlorophenyl)-3-quinoxalin-6-yl-3,4-dihydropyrazol-2-yl]-4-oxobutanoyl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 170949141 |
| Molecular Formula | C27H27ClN4O5 |
| Molecular Weight | 522.99 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | [4-[5-(4-chlorophenyl)-3-quinoxalin-6-yl-3,4-dihydropyrazol-2-yl]-4-oxobutanoyl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)CCC(=O)N1N=C(c2ccc(Cl)cc2)CC1c1ccc2nccnc2c1 |
| InChI | InChI=1S/C27H27ClN4O5/c1-27(2,3)26(35)37-16-36-25(34)11-10-24(33)32-23(15-21(31-32)17-4-7-19(28)8-5-17)18-6-9-20-22(14-18)30-13-12-29-20/h4-9,12-14,23H,10-11,15-16H2,1-3H3 |
| InChIKey | SLQAIMYDGRVVEX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 111.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.99 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|