C12H7FN4O2S2 — CID 170949693
N-(3-cyano-4-fluoro-1H-indol-7-yl)-1,3-thiazole-5-sulfonamide (PubChem CID 170949693) has the molecular formula C12H7FN4O2S2 and a molecular weight of 322.35 g/mol. Its IUPAC name is N-(3-cyano-4-fluoro-1H-indol-7-yl)-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(3-cyano-4-fluoro-1H-indol-7-yl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 170949693 |
| Molecular Formula | C12H7FN4O2S2 |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | N-(3-cyano-4-fluoro-1H-indol-7-yl)-1,3-thiazole-5-sulfonamide |
| SMILES | N#Cc1c[nH]c2c(NS(=O)(=O)c3cncs3)ccc(F)c12 |
| InChI | InChI=1S/C12H7FN4O2S2/c13-8-1-2-9(12-11(8)7(3-14)4-16-12)17-21(18,19)10-5-15-6-20-10/h1-2,4-6,16-17H |
| InChIKey | MGSUCPKCPIMEJF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |