C26H28FN3O2 — CID 170951009
methyl 3-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1H-indole-6-carboxylate (PubChem CID 170951009) has the molecular formula C26H28FN3O2 and a molecular weight of 433.53 g/mol. Its IUPAC name is methyl 3-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1H-indole-6-carboxylate.
| Compound Name | methyl 3-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 170951009 |
| Molecular Formula | C26H28FN3O2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | methyl 3-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c([C@@H]3c4[nH]c5ccccc5c4C[C@@H](C)N3CC(C)(C)F)c[nH]c2c1 |
| InChI | InChI=1S/C26H28FN3O2/c1-15-11-19-17-7-5-6-8-21(17)29-23(19)24(30(15)14-26(2,3)27)20-13-28-22-12-16(25(31)32-4)9-10-18(20)22/h5-10,12-13,15,24,28-29H,11,14H2,1-4H3/t15-,24-/m1/s1 |
| InChIKey | LPXFCWUELPJZBO-OYLFLEFRSA-N |
| XLogP | 5.52 |
| TPSA | 61.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|