C19H21BrClNO3 — CID 17095115
2-(2-bromo-4-chlorophenoxy)-N-(3-butoxyphenyl)propanamide (PubChem CID 17095115) has the molecular formula C19H21BrClNO3 and a molecular weight of 426.74 g/mol. Its IUPAC name is 2-(2-bromo-4-chlorophenoxy)-N-(3-butoxyphenyl)propanamide.
| Compound Name | 2-(2-bromo-4-chlorophenoxy)-N-(3-butoxyphenyl)propanamide |
|---|---|
| PubChem CID | 17095115 |
| Molecular Formula | C19H21BrClNO3 |
| Molecular Weight | 426.74 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 2-(2-bromo-4-chlorophenoxy)-N-(3-butoxyphenyl)propanamide |
| SMILES | CCCCOc1cccc(NC(=O)C(C)Oc2ccc(Cl)cc2Br)c1 |
| InChI | InChI=1S/C19H21BrClNO3/c1-3-4-10-24-16-7-5-6-15(12-16)22-19(23)13(2)25-18-9-8-14(21)11-17(18)20/h5-9,11-13H,3-4,10H2,1-2H3,(H,22,23) |
| InChIKey | MBOZFMBSPQCMKG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.74 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|