C18H13Cl2N5O — CID 170951373
4-(chloromethyl)-2-(15-chloro-10-methyl-2,4,10,11-tetrazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,11,14,16-heptaen-5-yl)-1,3-oxazole (PubChem CID 170951373) has the molecular formula C18H13Cl2N5O and a molecular weight of 386.24 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(15-chloro-10-methyl-2,4,10,11-tetrazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,11,14,16-heptaen-5-yl)-1,3-oxazole.
| Compound Name | 4-(chloromethyl)-2-(15-chloro-10-methyl-2,4,10,11-tetrazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,11,14,16-heptaen-5-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 170951373 |
| Molecular Formula | C18H13Cl2N5O |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 4-(chloromethyl)-2-(15-chloro-10-methyl-2,4,10,11-tetrazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,11,14,16-heptaen-5-yl)-1,3-oxazole |
| SMILES | Cn1cc2c(n1)-c1cc(Cl)ccc1-n1cnc(-c3nc(CCl)co3)c1C2 |
| InChI | InChI=1S/C18H13Cl2N5O/c1-24-7-10-4-15-17(18-22-12(6-19)8-26-18)21-9-25(15)14-3-2-11(20)5-13(14)16(10)23-24/h2-3,5,7-9H,4,6H2,1H3 |
| InChIKey | HTPYCMGOCPLFRI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|