C20H21N5O2 — CID 170951445
3-(4-ethyl-1,3-oxazol-2-yl)-8-methoxy-5-(methyliminomethyl)-4H-imidazo[1,5-a][1]benzazepin-6-amine (PubChem CID 170951445) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 3-(4-ethyl-1,3-oxazol-2-yl)-8-methoxy-5-(methyliminomethyl)-4H-imidazo[1,5-a][1]benzazepin-6-amine.
| Compound Name | 3-(4-ethyl-1,3-oxazol-2-yl)-8-methoxy-5-(methyliminomethyl)-4H-imidazo[1,5-a][1]benzazepin-6-amine |
|---|---|
| PubChem CID | 170951445 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 3-(4-ethyl-1,3-oxazol-2-yl)-8-methoxy-5-(methyliminomethyl)-4H-imidazo[1,5-a][1]benzazepin-6-amine |
| SMILES | CCc1coc(-c2ncn3c2CC(/C=N/C)=C(N)c2cc(OC)ccc2-3)n1 |
| InChI | InChI=1S/C20H21N5O2/c1-4-13-10-27-20(24-13)19-17-7-12(9-22-2)18(21)15-8-14(26-3)5-6-16(15)25(17)11-23-19/h5-6,8-11H,4,7,21H2,1-3H3/b22-9+ |
| InChIKey | VWVMRLSMJSDVCD-LSFURLLWSA-N |
| XLogP | 3.02 |
| TPSA | 91.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|