C12H14BN3O2 — CID 170951709
1-(2-methyl-4-nitrophenyl)-1,4-azaborinane-4-carbonitrile (PubChem CID 170951709) has the molecular formula C12H14BN3O2 and a molecular weight of 243.08 g/mol. Its IUPAC name is 1-(2-methyl-4-nitrophenyl)-1,4-azaborinane-4-carbonitrile.
| Compound Name | 1-(2-methyl-4-nitrophenyl)-1,4-azaborinane-4-carbonitrile |
|---|---|
| PubChem CID | 170951709 |
| Molecular Formula | C12H14BN3O2 |
| Molecular Weight | 243.08 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 1-(2-methyl-4-nitrophenyl)-1,4-azaborinane-4-carbonitrile |
| SMILES | Cc1cc([N+](=O)[O-])ccc1N1CCB(C#N)CC1 |
| InChI | InChI=1S/C12H14BN3O2/c1-10-8-11(16(17)18)2-3-12(10)15-6-4-13(9-14)5-7-15/h2-3,8H,4-7H2,1H3 |
| InChIKey | WCJBQRDDTSCDBK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.08 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|