C21H39FN2 — CID 170952508
4-fluoro-1-(3-propan-2-ylcyclobutyl)-4-[(1-propan-2-ylpiperidin-4-yl)methyl]piperidine (PubChem CID 170952508) has the molecular formula C21H39FN2 and a molecular weight of 338.56 g/mol. Its IUPAC name is 4-fluoro-1-(3-propan-2-ylcyclobutyl)-4-[(1-propan-2-ylpiperidin-4-yl)methyl]piperidine.
| Compound Name | 4-fluoro-1-(3-propan-2-ylcyclobutyl)-4-[(1-propan-2-ylpiperidin-4-yl)methyl]piperidine |
|---|---|
| PubChem CID | 170952508 |
| Molecular Formula | C21H39FN2 |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.31 |
| IUPAC Name | 4-fluoro-1-(3-propan-2-ylcyclobutyl)-4-[(1-propan-2-ylpiperidin-4-yl)methyl]piperidine |
| SMILES | CC(C)C1CC(N2CCC(F)(CC3CCN(C(C)C)CC3)CC2)C1 |
| InChI | InChI=1S/C21H39FN2/c1-16(2)19-13-20(14-19)24-11-7-21(22,8-12-24)15-18-5-9-23(10-6-18)17(3)4/h16-20H,5-15H2,1-4H3 |
| InChIKey | LXFJPOSRRGGVSX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |