C15H11BrCl2N2O4 — CID 17095298
2-(2-bromo-4,6-dichlorophenoxy)-N-(2-methyl-4-nitrophenyl)acetamide (PubChem CID 17095298) has the molecular formula C15H11BrCl2N2O4 and a molecular weight of 434.07 g/mol. Its IUPAC name is 2-(2-bromo-4,6-dichlorophenoxy)-N-(2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-(2-bromo-4,6-dichlorophenoxy)-N-(2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 17095298 |
| Molecular Formula | C15H11BrCl2N2O4 |
| Molecular Weight | 434.07 g/mol |
| Exact Mass | 431.93 |
| IUPAC Name | 2-(2-bromo-4,6-dichlorophenoxy)-N-(2-methyl-4-nitrophenyl)acetamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)COc1c(Cl)cc(Cl)cc1Br |
| InChI | InChI=1S/C15H11BrCl2N2O4/c1-8-4-10(20(22)23)2-3-13(8)19-14(21)7-24-15-11(16)5-9(17)6-12(15)18/h2-6H,7H2,1H3,(H,19,21) |
| InChIKey | BQMYVSMZBXYOGC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.07 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|