C16H15BrCl2N2O4S — CID 17095349
2-(2-bromo-4,6-dichlorophenoxy)-N-[4-(dimethylsulfamoyl)phenyl]acetamide (PubChem CID 17095349) has the molecular formula C16H15BrCl2N2O4S and a molecular weight of 482.18 g/mol. Its IUPAC name is 2-(2-bromo-4,6-dichlorophenoxy)-N-[4-(dimethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(2-bromo-4,6-dichlorophenoxy)-N-[4-(dimethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 17095349 |
| Molecular Formula | C16H15BrCl2N2O4S |
| Molecular Weight | 482.18 g/mol |
| Exact Mass | 479.93 |
| IUPAC Name | 2-(2-bromo-4,6-dichlorophenoxy)-N-[4-(dimethylsulfamoyl)phenyl]acetamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC(=O)COc2c(Cl)cc(Cl)cc2Br)cc1 |
| InChI | InChI=1S/C16H15BrCl2N2O4S/c1-21(2)26(23,24)12-5-3-11(4-6-12)20-15(22)9-25-16-13(17)7-10(18)8-14(16)19/h3-8H,9H2,1-2H3,(H,20,22) |
| InChIKey | STQJCWRMJXRBHA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.18 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |