C11H21N3O — CID 170957230
N-methyl-2-[(5-prop-2-enyl-1,2,4-oxadiazol-3-yl)methyl]butan-1-amine;molecular hydrogen (PubChem CID 170957230) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is N-methyl-2-[(5-prop-2-enyl-1,2,4-oxadiazol-3-yl)methyl]butan-1-amine;molecular hydrogen.
| Compound Name | N-methyl-2-[(5-prop-2-enyl-1,2,4-oxadiazol-3-yl)methyl]butan-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 170957230 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | N-methyl-2-[(5-prop-2-enyl-1,2,4-oxadiazol-3-yl)methyl]butan-1-amine;molecular hydrogen |
| SMILES | C=CCc1nc(CC(CC)CNC)no1.[H][H] |
| InChI | InChI=1S/C11H19N3O.H2/c1-4-6-11-13-10(14-15-11)7-9(5-2)8-12-3;/h4,9,12H,1,5-8H2,2-3H3;1H |
| InChIKey | DBVIRBQECXVHEM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|