C10H12F3NO4S — CID 170957561
(3-amino-2,3-dihydro-1-benzofuran-6-yl) trifluoromethanesulfonate;methane (PubChem CID 170957561) has the molecular formula C10H12F3NO4S and a molecular weight of 299.27 g/mol. Its IUPAC name is (3-amino-2,3-dihydro-1-benzofuran-6-yl) trifluoromethanesulfonate;methane.
| Compound Name | (3-amino-2,3-dihydro-1-benzofuran-6-yl) trifluoromethanesulfonate;methane |
|---|---|
| PubChem CID | 170957561 |
| Molecular Formula | C10H12F3NO4S |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | (3-amino-2,3-dihydro-1-benzofuran-6-yl) trifluoromethanesulfonate;methane |
| SMILES | C.NC1COc2cc(OS(=O)(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C9H8F3NO4S.CH4/c10-9(11,12)18(14,15)17-5-1-2-6-7(13)4-16-8(6)3-5;/h1-3,7H,4,13H2;1H4 |
| InChIKey | VHTJSBYFWQAGPB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|