C14H16F3NO6S — CID 170957575
[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate (PubChem CID 170957575) has the molecular formula C14H16F3NO6S and a molecular weight of 383.34 g/mol. Its IUPAC name is [3-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate.
| Compound Name | [3-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 170957575 |
| Molecular Formula | C14H16F3NO6S |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | [3-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)NC1COc2cc(OS(=O)(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C14H16F3NO6S/c1-13(2,3)23-12(19)18-10-7-22-11-6-8(4-5-9(10)11)24-25(20,21)14(15,16)17/h4-6,10H,7H2,1-3H3,(H,18,19) |
| InChIKey | ILPYGLBJCYZQTA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|