C22H28BClNO — CID 170957969
CID 170957969 (PubChem CID 170957969) has the molecular formula C22H28BClNO and a molecular weight of 368.74 g/mol.
| Compound Name | CID 170957969 |
|---|---|
| PubChem CID | 170957969 |
| Molecular Formula | C22H28BClNO |
| Molecular Weight | 368.74 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | — |
| SMILES | C[B]c1ccc(OC)cc1.Clc1ccc2c(c1)CC(N1CCCC1)CC2 |
| InChI | InChI=1S/C14H18ClN.C8H10BO/c15-13-5-3-11-4-6-14(10-12(11)9-13)16-7-1-2-8-16;1-9-7-3-5-8(10-2)6-4-7/h3,5,9,14H,1-2,4,6-8,10H2;3-6H,1-2H3 |
| InChIKey | SRHXYPFDHFAGAY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.74 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|