C27H34ClNO2S — CID 170958152
[4-[[(3R)-1-(7-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)piperidin-3-yl]methoxy]phenyl]-cyclobutylidene-methyl-oxo-λ6-sulfane (PubChem CID 170958152) has the molecular formula C27H34ClNO2S and a molecular weight of 472.09 g/mol. Its IUPAC name is [4-[[(3R)-1-(7-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)piperidin-3-yl]methoxy]phenyl]-cyclobutylidene-methyl-oxo-λ6-sulfane.
| Compound Name | [4-[[(3R)-1-(7-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)piperidin-3-yl]methoxy]phenyl]-cyclobutylidene-methyl-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 170958152 |
| Molecular Formula | C27H34ClNO2S |
| Molecular Weight | 472.09 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | [4-[[(3R)-1-(7-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)piperidin-3-yl]methoxy]phenyl]-cyclobutylidene-methyl-oxo-λ6-sulfane |
| SMILES | CS(=O)(=C1CCC1)c1ccc(OC[C@@H]2CCCN(C3CCc4ccc(Cl)cc4C3)C2)cc1 |
| InChI | InChI=1S/C27H34ClNO2S/c1-32(30,26-5-2-6-26)27-13-11-25(12-14-27)31-19-20-4-3-15-29(18-20)24-10-8-21-7-9-23(28)16-22(21)17-24/h7,9,11-14,16,20,24H,2-6,8,10,15,17-19H2,1H3/t20-,24?,32?/m1/s1 |
| InChIKey | COOUCIARGLJPQO-PFWRVHRGSA-N |
| XLogP | 5.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.09 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|