C27H35N3O — CID 170958102
4-methoxy-N-methyl-2-pent-1-ynylaniline;3-[2-(3-methylpyrrolidin-1-yl)ethyl]benzonitrile (PubChem CID 170958102) has the molecular formula C27H35N3O and a molecular weight of 417.60 g/mol. Its IUPAC name is 4-methoxy-N-methyl-2-pent-1-ynylaniline;3-[2-(3-methylpyrrolidin-1-yl)ethyl]benzonitrile.
| Compound Name | 4-methoxy-N-methyl-2-pent-1-ynylaniline;3-[2-(3-methylpyrrolidin-1-yl)ethyl]benzonitrile |
|---|---|
| PubChem CID | 170958102 |
| Molecular Formula | C27H35N3O |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | 4-methoxy-N-methyl-2-pent-1-ynylaniline;3-[2-(3-methylpyrrolidin-1-yl)ethyl]benzonitrile |
| SMILES | CC1CCN(CCc2cccc(C#N)c2)C1.CCCC#Cc1cc(OC)ccc1NC |
| InChI | InChI=1S/C14H18N2.C13H17NO/c1-12-5-7-16(11-12)8-6-13-3-2-4-14(9-13)10-15;1-4-5-6-7-11-10-12(15-3)8-9-13(11)14-2/h2-4,9,12H,5-8,11H2,1H3;8-10,14H,4-5H2,1-3H3 |
| InChIKey | XNOVXXLXHNZKMP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|