C24H22ClF2IN2O3 — CID 170961783
2-chloro-4-[1-cyclopropyloxy-1-(3,5-difluorophenyl)-2-(oxan-2-yloxy)ethyl]-6-iodoquinazoline (PubChem CID 170961783) has the molecular formula C24H22ClF2IN2O3 and a molecular weight of 586.80 g/mol. Its IUPAC name is 2-chloro-4-[1-cyclopropyloxy-1-(3,5-difluorophenyl)-2-(oxan-2-yloxy)ethyl]-6-iodoquinazoline.
| Compound Name | 2-chloro-4-[1-cyclopropyloxy-1-(3,5-difluorophenyl)-2-(oxan-2-yloxy)ethyl]-6-iodoquinazoline |
|---|---|
| PubChem CID | 170961783 |
| Molecular Formula | C24H22ClF2IN2O3 |
| Molecular Weight | 586.80 g/mol |
| Exact Mass | 586.03 |
| IUPAC Name | 2-chloro-4-[1-cyclopropyloxy-1-(3,5-difluorophenyl)-2-(oxan-2-yloxy)ethyl]-6-iodoquinazoline |
| SMILES | Fc1cc(F)cc(C(COC2CCCCO2)(OC2CC2)c2nc(Cl)nc3ccc(I)cc23)c1 |
| InChI | InChI=1S/C24H22ClF2IN2O3/c25-23-29-20-7-4-17(28)12-19(20)22(30-23)24(33-18-5-6-18,13-32-21-3-1-2-8-31-21)14-9-15(26)11-16(27)10-14/h4,7,9-12,18,21H,1-3,5-6,8,13H2 |
| InChIKey | HSRBTJCYBFZZCC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.80 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|