C11H11NO4S — CID 170963194
2-(2,3-dihydro-1,4-benzoxathiine-7-carbonylamino)acetic acid (PubChem CID 170963194) has the molecular formula C11H11NO4S and a molecular weight of 253.28 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzoxathiine-7-carbonylamino)acetic acid.
| Compound Name | 2-(2,3-dihydro-1,4-benzoxathiine-7-carbonylamino)acetic acid |
|---|---|
| PubChem CID | 170963194 |
| Molecular Formula | C11H11NO4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzoxathiine-7-carbonylamino)acetic acid |
| SMILES | O=C(O)CNC(=O)c1ccc2c(c1)OCCS2 |
| InChI | InChI=1S/C11H11NO4S/c13-10(14)6-12-11(15)7-1-2-9-8(5-7)16-3-4-17-9/h1-2,5H,3-4,6H2,(H,12,15)(H,13,14) |
| InChIKey | QDUYDMMSZAGMLE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |